C9H17F3N2O — CID 65258748
2,2-dimethyl-5-(2,2,2-trifluoroethoxy)pentanimidamide (PubChem CID 65258748) has the molecular formula C9H17F3N2O and a molecular weight of 226.24 g/mol. Its IUPAC name is 2,2-dimethyl-5-(2,2,2-trifluoroethoxy)pentanimidamide.
| Compound Name | 2,2-dimethyl-5-(2,2,2-trifluoroethoxy)pentanimidamide |
|---|---|
| PubChem CID | 65258748 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2,2-dimethyl-5-(2,2,2-trifluoroethoxy)pentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCOCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O/c1-8(2,7(13)14)4-3-5-15-6-9(10,11)12/h3-6H2,1-2H3,(H3,13,14) |
| InChIKey | PYFUNWAVNHTSSF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|