C12H22O4 — CID 65259862
2,2-dimethyl-5-(oxolan-2-ylmethoxy)pentanoic acid (PubChem CID 65259862) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 2,2-dimethyl-5-(oxolan-2-ylmethoxy)pentanoic acid.
| Compound Name | 2,2-dimethyl-5-(oxolan-2-ylmethoxy)pentanoic acid |
|---|---|
| PubChem CID | 65259862 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2,2-dimethyl-5-(oxolan-2-ylmethoxy)pentanoic acid |
| SMILES | CC(C)(CCCOCC1CCCO1)C(=O)O |
| InChI | InChI=1S/C12H22O4/c1-12(2,11(13)14)6-4-7-15-9-10-5-3-8-16-10/h10H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | GIQZJQLQWXYCQY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|