C12H17NO2S — CID 65259922
2,2-dimethyl-5-pyridin-2-ylsulfanylpentanoic acid (PubChem CID 65259922) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 2,2-dimethyl-5-pyridin-2-ylsulfanylpentanoic acid.
| Compound Name | 2,2-dimethyl-5-pyridin-2-ylsulfanylpentanoic acid |
|---|---|
| PubChem CID | 65259922 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2,2-dimethyl-5-pyridin-2-ylsulfanylpentanoic acid |
| SMILES | CC(C)(CCCSc1ccccn1)C(=O)O |
| InChI | InChI=1S/C12H17NO2S/c1-12(2,11(14)15)7-5-9-16-10-6-3-4-8-13-10/h3-4,6,8H,5,7,9H2,1-2H3,(H,14,15) |
| InChIKey | KJUSZMURZOHSLF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|