C16H23N5S — CID 652611
4-[1-(1-benzyltetrazol-5-yl)-2-methylpropyl]thiomorpholine (PubChem CID 652611) has the molecular formula C16H23N5S and a molecular weight of 317.46 g/mol. Its IUPAC name is 4-[1-(1-benzyltetrazol-5-yl)-2-methylpropyl]thiomorpholine.
| Compound Name | 4-[1-(1-benzyltetrazol-5-yl)-2-methylpropyl]thiomorpholine |
|---|---|
| PubChem CID | 652611 |
| Molecular Formula | C16H23N5S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-[1-(1-benzyltetrazol-5-yl)-2-methylpropyl]thiomorpholine |
| SMILES | CC(C)C(c1nnnn1Cc1ccccc1)N1CCSCC1 |
| InChI | InChI=1S/C16H23N5S/c1-13(2)15(20-8-10-22-11-9-20)16-17-18-19-21(16)12-14-6-4-3-5-7-14/h3-7,13,15H,8-12H2,1-2H3 |
| InChIKey | GLTCMKZKHZVDCB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |