C14H17FN2O2 — CID 65261333
3-(3-fluorophenyl)-5,5,6,6-tetramethyl-1,3-diazinane-2,4-dione (PubChem CID 65261333) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5,5,6,6-tetramethyl-1,3-diazinane-2,4-dione.
| Compound Name | 3-(3-fluorophenyl)-5,5,6,6-tetramethyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 65261333 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-(3-fluorophenyl)-5,5,6,6-tetramethyl-1,3-diazinane-2,4-dione |
| SMILES | CC1(C)NC(=O)N(c2cccc(F)c2)C(=O)C1(C)C |
| InChI | InChI=1S/C14H17FN2O2/c1-13(2)11(18)17(12(19)16-14(13,3)4)10-7-5-6-9(15)8-10/h5-8H,1-4H3,(H,16,19) |
| InChIKey | SJWCSJZFBBNEIO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |