About 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine
3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine (PubChem CID 65261664) has the molecular formula C13H17BrN2S
and a molecular weight of 313.26 g/mol. Its IUPAC name is 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine |
| PubChem CID | 65261664 |
| Molecular Formula | C13H17BrN2S |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine |
| SMILES | CC(C)(N)C(C)(C)c1nc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C13H17BrN2S/c1-12(2,13(3,4)15)11-16-9-7-8(14)5-6-10(9)17-11/h5-7H,15H2,1-4H3 |
| InChIKey | XSYOHPFDCFCKRE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine?
The IUPAC name of 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine (CID 65261664) is 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine.
What is the SMILES notation for 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine?
The canonical SMILES for 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine is CC(C)(N)C(C)(C)c1nc2cc(Br)ccc2s1.
What is the InChIKey of 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine?
The InChIKey is XSYOHPFDCFCKRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrN2S/c1-12(2,13(3,4)15)11-16-9-7-8(14)5-6-10(9)17-11/h5-7H,15H2,1-4H3.
What are the key properties of 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine?
3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine has a molecular weight of 313.26 g/mol, XLogP of 4.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-1,3-benzothiazol-2-yl)-2,3-dimethylbutan-2-amine is sourced from PubChem (CID 65261664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).