C17H22N2O2 — CID 65262345
3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl(1,2,3,4-tetrahydroisoquinolin-4-yl)methanone (PubChem CID 65262345) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl(1,2,3,4-tetrahydroisoquinolin-4-yl)methanone.
| Compound Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl(1,2,3,4-tetrahydroisoquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 65262345 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl(1,2,3,4-tetrahydroisoquinolin-4-yl)methanone |
| SMILES | O=C(C1CNCc2ccccc21)N1CCOC2CCCC21 |
| InChI | InChI=1S/C17H22N2O2/c20-17(19-8-9-21-16-7-3-6-15(16)19)14-11-18-10-12-4-1-2-5-13(12)14/h1-2,4-5,14-16,18H,3,6-11H2 |
| InChIKey | AODIFHHVQLBTSV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |