About 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine
5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine (PubChem CID 65262693) has the molecular formula C12H25NO2S
and a molecular weight of 247.40 g/mol. Its IUPAC name is 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine |
| PubChem CID | 65262693 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine |
| SMILES | CC(C)(CN)CCCS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C12H25NO2S/c1-12(2,10-13)8-5-9-16(14,15)11-6-3-4-7-11/h11H,3-10,13H2,1-2H3 |
| InChIKey | QFGXSIWHDJKXPZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine?
The IUPAC name of 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine (CID 65262693) is 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine.
What is the SMILES notation for 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine?
The canonical SMILES for 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine is CC(C)(CN)CCCS(=O)(=O)C1CCCC1.
What is the InChIKey of 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine?
The InChIKey is QFGXSIWHDJKXPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2S/c1-12(2,10-13)8-5-9-16(14,15)11-6-3-4-7-11/h11H,3-10,13H2,1-2H3.
What are the key properties of 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine?
5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine has a molecular weight of 247.40 g/mol, XLogP of 2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentylsulfonyl-2,2-dimethylpentan-1-amine is sourced from PubChem (CID 65262693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).