About 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine
5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine (PubChem CID 65262743) has the molecular formula C13H27NO2S
and a molecular weight of 261.43 g/mol. Its IUPAC name is 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine |
| PubChem CID | 65262743 |
| Molecular Formula | C13H27NO2S |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine |
| SMILES | CC(C)(CN)CCCS(=O)(=O)CC1CCCC1 |
| InChI | InChI=1S/C13H27NO2S/c1-13(2,11-14)8-5-9-17(15,16)10-12-6-3-4-7-12/h12H,3-11,14H2,1-2H3 |
| InChIKey | DMOVGXOQAXAGDD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine?
The IUPAC name of 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine (CID 65262743) is 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine.
What is the SMILES notation for 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine?
The canonical SMILES for 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine is CC(C)(CN)CCCS(=O)(=O)CC1CCCC1.
What is the InChIKey of 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine?
The InChIKey is DMOVGXOQAXAGDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2S/c1-13(2,11-14)8-5-9-17(15,16)10-12-6-3-4-7-12/h12H,3-11,14H2,1-2H3.
What are the key properties of 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine?
5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine has a molecular weight of 261.43 g/mol, XLogP of 2.36, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclopentylmethylsulfonyl)-2,2-dimethylpentan-1-amine is sourced from PubChem (CID 65262743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).