C17H25NOS — CID 65262891
5-(4-tert-butylphenyl)sulfinyl-2,2-dimethylpentanenitrile (PubChem CID 65262891) has the molecular formula C17H25NOS and a molecular weight of 291.46 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)sulfinyl-2,2-dimethylpentanenitrile.
| Compound Name | 5-(4-tert-butylphenyl)sulfinyl-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65262891 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 5-(4-tert-butylphenyl)sulfinyl-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCS(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25NOS/c1-16(2,3)14-7-9-15(10-8-14)20(19)12-6-11-17(4,5)13-18/h7-10H,6,11-12H2,1-5H3 |
| InChIKey | PLWLPWUQBZAFEE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |