About 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine
5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine (PubChem CID 65263093) has the molecular formula C11H25NO2S
and a molecular weight of 235.39 g/mol. Its IUPAC name is 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine |
| PubChem CID | 65263093 |
| Molecular Formula | C11H25NO2S |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine |
| SMILES | CCC(C)S(=O)(=O)CCCC(C)(C)CN |
| InChI | InChI=1S/C11H25NO2S/c1-5-10(2)15(13,14)8-6-7-11(3,4)9-12/h10H,5-9,12H2,1-4H3 |
| InChIKey | PUCUGKHFFUZIRH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine?
The IUPAC name of 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine (CID 65263093) is 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine.
What is the SMILES notation for 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine?
The canonical SMILES for 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine is CCC(C)S(=O)(=O)CCCC(C)(C)CN.
What is the InChIKey of 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine?
The InChIKey is PUCUGKHFFUZIRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO2S/c1-5-10(2)15(13,14)8-6-7-11(3,4)9-12/h10H,5-9,12H2,1-4H3.
What are the key properties of 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine?
5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine has a molecular weight of 235.39 g/mol, XLogP of 1.96, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-ylsulfonyl-2,2-dimethylpentan-1-amine is sourced from PubChem (CID 65263093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).