C13H28N2O3 — CID 65264293
3-amino-N,N-bis(2-methoxyethyl)-2,2,3-trimethylbutanamide (PubChem CID 65264293) has the molecular formula C13H28N2O3 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-amino-N,N-bis(2-methoxyethyl)-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N,N-bis(2-methoxyethyl)-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 65264293 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 3-amino-N,N-bis(2-methoxyethyl)-2,2,3-trimethylbutanamide |
| SMILES | COCCN(CCOC)C(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C13H28N2O3/c1-12(2,13(3,4)14)11(16)15(7-9-17-5)8-10-18-6/h7-10,14H2,1-6H3 |
| InChIKey | OQPTWBXWXBRASO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |