About 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid
3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid (PubChem CID 65265732) has the molecular formula C9H18N2O3
and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid.
Molecular Properties
| Compound Name | 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid |
| PubChem CID | 65265732 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid |
| SMILES | CC(C)(NC(=O)CN)C(C)(C)C(=O)O |
| InChI | InChI=1S/C9H18N2O3/c1-8(2,7(13)14)9(3,4)11-6(12)5-10/h5,10H2,1-4H3,(H,11,12)(H,13,14) |
| InChIKey | FPNSLRYOBYGKPC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid?
The IUPAC name of 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid (CID 65265732) is 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid.
What is the SMILES notation for 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid?
The canonical SMILES for 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid is CC(C)(NC(=O)CN)C(C)(C)C(=O)O.
What is the InChIKey of 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid?
The InChIKey is FPNSLRYOBYGKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3/c1-8(2,7(13)14)9(3,4)11-6(12)5-10/h5,10H2,1-4H3,(H,11,12)(H,13,14).
What are the key properties of 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid?
3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid has a molecular weight of 202.25 g/mol, XLogP of -0.05, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-aminoacetyl)amino]-2,2,3-trimethylbutanoic acid is sourced from PubChem (CID 65265732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).