C13H17N3O2 — CID 65265896
3-[(2-cyano-4-pyridinyl)amino]-2,2,3-trimethylbutanoic acid (PubChem CID 65265896) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-[(2-cyano-4-pyridinyl)amino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[(2-cyano-4-pyridinyl)amino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65265896 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3-[(2-cyano-4-pyridinyl)amino]-2,2,3-trimethylbutanoic acid |
| SMILES | CC(C)(Nc1ccnc(C#N)c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H17N3O2/c1-12(2,11(17)18)13(3,4)16-9-5-6-15-10(7-9)8-14/h5-7H,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | YUBJHAYSGZIPEC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |