C12H19NO4 — CID 65266415
2,2,3-trimethyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanoic acid (PubChem CID 65266415) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanoic acid.
| Compound Name | 2,2,3-trimethyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 65266415 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2,2,3-trimethyl-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanoic acid |
| SMILES | CC1CC(=O)N(C(C)(C)C(C)(C)C(=O)O)C1=O |
| InChI | InChI=1S/C12H19NO4/c1-7-6-8(14)13(9(7)15)12(4,5)11(2,3)10(16)17/h7H,6H2,1-5H3,(H,16,17) |
| InChIKey | UUONKEUFPXMCHH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|