C10H19N3S — CID 65267527
N,3-bis(2-methylpropyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65267527) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is N,3-bis(2-methylpropyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N,3-bis(2-methylpropyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65267527 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N,3-bis(2-methylpropyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)CNc1nc(CC(C)C)ns1 |
| InChI | InChI=1S/C10H19N3S/c1-7(2)5-9-12-10(14-13-9)11-6-8(3)4/h7-8H,5-6H2,1-4H3,(H,11,12,13) |
| InChIKey | KKUAQTSIWUMYET-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |