C10H19N3S2 — CID 65267700
N-(2-methylpropyl)-3-(propylsulfanylmethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65267700) has the molecular formula C10H19N3S2 and a molecular weight of 245.42 g/mol. Its IUPAC name is N-(2-methylpropyl)-3-(propylsulfanylmethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-methylpropyl)-3-(propylsulfanylmethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65267700 |
| Molecular Formula | C10H19N3S2 |
| Molecular Weight | 245.42 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-(2-methylpropyl)-3-(propylsulfanylmethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCCSCc1nsc(NCC(C)C)n1 |
| InChI | InChI=1S/C10H19N3S2/c1-4-5-14-7-9-12-10(15-13-9)11-6-8(2)3/h8H,4-7H2,1-3H3,(H,11,12,13) |
| InChIKey | NPFIMOGOIVABNG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|