About N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide
N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide (PubChem CID 652679) has the molecular formula C24H30N4O4
and a molecular weight of 438.53 g/mol. Its IUPAC name is N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide.
Molecular Properties
| Compound Name | N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide |
| PubChem CID | 652679 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide |
| SMILES | COc1ccccc1N(CC(=O)NC1CCCCC1)C(=O)CCC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C24H30N4O4/c1-32-20-12-6-5-11-19(20)28(17-23(30)26-18-9-3-2-4-10-18)24(31)15-14-22(29)27-21-13-7-8-16-25-21/h5-8,11-13,16,18H,2-4,9-10,14-15,17H2,1H3,(H,26,30)(H,25,27,29) |
| InChIKey | BVVNABPDXDRMPY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide?
The IUPAC name of N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide (CID 652679) is N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide.
What is the SMILES notation for N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide?
The canonical SMILES for N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide is COc1ccccc1N(CC(=O)NC1CCCCC1)C(=O)CCC(=O)Nc1ccccn1.
What is the InChIKey of N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide?
The InChIKey is BVVNABPDXDRMPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N4O4/c1-32-20-12-6-5-11-19(20)28(17-23(30)26-18-9-3-2-4-10-18)24(31)15-14-22(29)27-21-13-7-8-16-25-21/h5-8,11-13,16,18H,2-4,9-10,14-15,17H2,1H3,(H,26,30)(H,25,27,29).
What are the key properties of N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide?
N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide has a molecular weight of 438.53 g/mol, XLogP of 3.29, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(2-methoxyphenyl)-N-pyridin-2-ylbutanediamide is sourced from PubChem (CID 652679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).