C10H20N4S — CID 65268031
N,N,2,2-tetramethyl-N'-(3-methyl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine (PubChem CID 65268031) has the molecular formula C10H20N4S and a molecular weight of 228.36 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-N'-(3-methyl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine.
| Compound Name | N,N,2,2-tetramethyl-N'-(3-methyl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 65268031 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N,N,2,2-tetramethyl-N'-(3-methyl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine |
| SMILES | Cc1nsc(NCC(C)(C)CN(C)C)n1 |
| InChI | InChI=1S/C10H20N4S/c1-8-12-9(15-13-8)11-6-10(2,3)7-14(4)5/h6-7H2,1-5H3,(H,11,12,13) |
| InChIKey | IZRKZVXGCYQQRS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |