C12H13F2N3S — CID 65268612
N-tert-butyl-3-(3,5-difluorophenyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65268612) has the molecular formula C12H13F2N3S and a molecular weight of 269.32 g/mol. Its IUPAC name is N-tert-butyl-3-(3,5-difluorophenyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-tert-butyl-3-(3,5-difluorophenyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65268612 |
| Molecular Formula | C12H13F2N3S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-tert-butyl-3-(3,5-difluorophenyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)(C)Nc1nc(-c2cc(F)cc(F)c2)ns1 |
| InChI | InChI=1S/C12H13F2N3S/c1-12(2,3)16-11-15-10(17-18-11)7-4-8(13)6-9(14)5-7/h4-6H,1-3H3,(H,15,16,17) |
| InChIKey | RTTBNBUKFMVEDE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |