C10H17N3OS — CID 65268927
3-(oxolan-2-ylmethyl)-N-propyl-1,2,4-thiadiazol-5-amine (PubChem CID 65268927) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethyl)-N-propyl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(oxolan-2-ylmethyl)-N-propyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65268927 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-(oxolan-2-ylmethyl)-N-propyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCCNc1nc(CC2CCCO2)ns1 |
| InChI | InChI=1S/C10H17N3OS/c1-2-5-11-10-12-9(13-15-10)7-8-4-3-6-14-8/h8H,2-7H2,1H3,(H,11,12,13) |
| InChIKey | WVNVJJPCIDHXCH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |