C15H30N2O — CID 65269620
3-amino-N-(cyclohexylmethyl)-N,2,2,3-tetramethylbutanamide (PubChem CID 65269620) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 3-amino-N-(cyclohexylmethyl)-N,2,2,3-tetramethylbutanamide.
| Compound Name | 3-amino-N-(cyclohexylmethyl)-N,2,2,3-tetramethylbutanamide |
|---|---|
| PubChem CID | 65269620 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 3-amino-N-(cyclohexylmethyl)-N,2,2,3-tetramethylbutanamide |
| SMILES | CN(CC1CCCCC1)C(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C15H30N2O/c1-14(2,15(3,4)16)13(18)17(5)11-12-9-7-6-8-10-12/h12H,6-11,16H2,1-5H3 |
| InChIKey | CKPNNOJEETWBBP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |