1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid

C13H24N2O3 — CID 65269823

IUPAC1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid
SMILESCC(C)(N)C(C)(C)C(=O)N1CCCC(C(=O)O)C1
InChIInChI=1S/C13H24N2O3/c1-12(2,13(3,4)14)11(18)15-7-5-6-9(8-15)10(16)17/h9H,5-8,14H2,1-4H3,(H,16,17)
InChIKeyZQBRIFCLZGDVJI-UHFFFAOYSA-N
MW256.35 g/mol
LogP1.07
Rot. Bonds3

About 1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid

1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid (PubChem CID 65269823) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid
PubChem CID65269823
Molecular FormulaC13H24N2O3
Molecular Weight256.35 g/mol
Exact Mass256.18
IUPAC Name1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid
SMILESCC(C)(N)C(C)(C)C(=O)N1CCCC(C(=O)O)C1
InChIInChI=1S/C13H24N2O3/c1-12(2,13(3,4)14)11(18)15-7-5-6-9(8-15)10(16)17/h9H,5-8,14H2,1-4H3,(H,16,17)
InChIKeyZQBRIFCLZGDVJI-UHFFFAOYSA-N
XLogP1.07
TPSA83.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.35
LogP ≤ 51.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid?
The IUPAC name of 1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid (CID 65269823) is 1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid is CC(C)(N)C(C)(C)C(=O)N1CCCC(C(=O)O)C1.
What is the InChIKey of 1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid?
The InChIKey is ZQBRIFCLZGDVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3/c1-12(2,13(3,4)14)11(18)15-7-5-6-9(8-15)10(16)17/h9H,5-8,14H2,1-4H3,(H,16,17).
What are the key properties of 1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid?
1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid has a molecular weight of 256.35 g/mol, XLogP of 1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-2,2,3-trimethylbutanoyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 65269823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).