About [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine
[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine (PubChem CID 65270348) has the molecular formula C9H16N4OS
and a molecular weight of 228.32 g/mol. Its IUPAC name is [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine.
Molecular Properties
| Compound Name | [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine |
| PubChem CID | 65270348 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine |
| SMILES | CCc1nsc(N2CCOC(CN)C2)n1 |
| InChI | InChI=1S/C9H16N4OS/c1-2-8-11-9(15-12-8)13-3-4-14-7(5-10)6-13/h7H,2-6,10H2,1H3 |
| InChIKey | GQSNLJDWZKSDAW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine?
The IUPAC name of [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine (CID 65270348) is [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine.
What is the SMILES notation for [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine?
The canonical SMILES for [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine is CCc1nsc(N2CCOC(CN)C2)n1.
What is the InChIKey of [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine?
The InChIKey is GQSNLJDWZKSDAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4OS/c1-2-8-11-9(15-12-8)13-3-4-14-7(5-10)6-13/h7H,2-6,10H2,1H3.
What are the key properties of [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine?
[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine has a molecular weight of 228.32 g/mol, XLogP of 0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methanamine is sourced from PubChem (CID 65270348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).