About 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol
2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol (PubChem CID 65271035) has the molecular formula C7H11N3OS
and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol |
| PubChem CID | 65271035 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol |
| SMILES | OCCNc1nc(C2CC2)ns1 |
| InChI | InChI=1S/C7H11N3OS/c11-4-3-8-7-9-6(10-12-7)5-1-2-5/h5,11H,1-4H2,(H,8,9,10) |
| InChIKey | GXWMHPMENOFBSC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol?
The IUPAC name of 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol (CID 65271035) is 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol.
What is the SMILES notation for 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol?
The canonical SMILES for 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol is OCCNc1nc(C2CC2)ns1.
What is the InChIKey of 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol?
The InChIKey is GXWMHPMENOFBSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3OS/c11-4-3-8-7-9-6(10-12-7)5-1-2-5/h5,11H,1-4H2,(H,8,9,10).
What are the key properties of 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol?
2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol has a molecular weight of 185.25 g/mol, XLogP of 0.82, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethanol is sourced from PubChem (CID 65271035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).