About N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide
N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide (PubChem CID 65271242) has the molecular formula C11H20N4O2S2
and a molecular weight of 304.44 g/mol. Its IUPAC name is N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide |
| PubChem CID | 65271242 |
| Molecular Formula | C11H20N4O2S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(CCCNc1nc(C2CC2)ns1)S(C)(=O)=O |
| InChI | InChI=1S/C11H20N4O2S2/c1-3-15(19(2,16)17)8-4-7-12-11-13-10(14-18-11)9-5-6-9/h9H,3-8H2,1-2H3,(H,12,13,14) |
| InChIKey | PPTDBRFNKXNFEM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide?
The IUPAC name of N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide (CID 65271242) is N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide.
What is the SMILES notation for N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide?
The canonical SMILES for N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide is CCN(CCCNc1nc(C2CC2)ns1)S(C)(=O)=O.
What is the InChIKey of N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide?
The InChIKey is PPTDBRFNKXNFEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O2S2/c1-3-15(19(2,16)17)8-4-7-12-11-13-10(14-18-11)9-5-6-9/h9H,3-8H2,1-2H3,(H,12,13,14).
What are the key properties of N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide?
N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide has a molecular weight of 304.44 g/mol, XLogP of 1.50, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide is sourced from PubChem (CID 65271242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).