About 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol
1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol (PubChem CID 65271270) has the molecular formula C8H15N3OS
and a molecular weight of 201.29 g/mol. Its IUPAC name is 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol |
| PubChem CID | 65271270 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol |
| SMILES | CC(O)CNc1nc(C(C)C)ns1 |
| InChI | InChI=1S/C8H15N3OS/c1-5(2)7-10-8(13-11-7)9-4-6(3)12/h5-6,12H,4H2,1-3H3,(H,9,10,11) |
| InChIKey | NUDOCZZRJPEEBY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol?
The IUPAC name of 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol (CID 65271270) is 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol.
What is the SMILES notation for 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol?
The canonical SMILES for 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol is CC(O)CNc1nc(C(C)C)ns1.
What is the InChIKey of 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol?
The InChIKey is NUDOCZZRJPEEBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3OS/c1-5(2)7-10-8(13-11-7)9-4-6(3)12/h5-6,12H,4H2,1-3H3,(H,9,10,11).
What are the key properties of 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol?
1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol has a molecular weight of 201.29 g/mol, XLogP of 1.45, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol is sourced from PubChem (CID 65271270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).