About methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate
methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate (PubChem CID 65271392) has the molecular formula C9H15N3O2S
and a molecular weight of 229.30 g/mol. Its IUPAC name is methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate.
Molecular Properties
| Compound Name | methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate |
| PubChem CID | 65271392 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate |
| SMILES | COC(=O)C(C)Nc1nc(C(C)C)ns1 |
| InChI | InChI=1S/C9H15N3O2S/c1-5(2)7-11-9(15-12-7)10-6(3)8(13)14-4/h5-6H,1-4H3,(H,10,11,12) |
| InChIKey | BJTQYXKKZUJDSS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate?
The IUPAC name of methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate (CID 65271392) is methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate.
What is the SMILES notation for methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate?
The canonical SMILES for methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate is COC(=O)C(C)Nc1nc(C(C)C)ns1.
What is the InChIKey of methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate?
The InChIKey is BJTQYXKKZUJDSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S/c1-5(2)7-11-9(15-12-7)10-6(3)8(13)14-4/h5-6H,1-4H3,(H,10,11,12).
What are the key properties of methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate?
methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate has a molecular weight of 229.30 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]propanoate is sourced from PubChem (CID 65271392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).