About N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine
N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 65271439) has the molecular formula C9H8FN3S
and a molecular weight of 209.25 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine |
| PubChem CID | 65271439 |
| Molecular Formula | C9H8FN3S |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | Fc1cccc(CNc2ncns2)c1 |
| InChI | InChI=1S/C9H8FN3S/c10-8-3-1-2-7(4-8)5-11-9-12-6-13-14-9/h1-4,6H,5H2,(H,11,12,13) |
| InChIKey | UMEKRYYYDGXUQS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine?
The IUPAC name of N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine (CID 65271439) is N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine?
The canonical SMILES for N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine is Fc1cccc(CNc2ncns2)c1.
What is the InChIKey of N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine?
The InChIKey is UMEKRYYYDGXUQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3S/c10-8-3-1-2-7(4-8)5-11-9-12-6-13-14-9/h1-4,6H,5H2,(H,11,12,13).
What are the key properties of N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine?
N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine has a molecular weight of 209.25 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 65271439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).