C10H17N3O2S2 — CID 65271624
N-(1,1-dioxothian-4-yl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 65271624) has the molecular formula C10H17N3O2S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65271624 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)c1nsc(NC2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C10H17N3O2S2/c1-7(2)9-12-10(16-13-9)11-8-3-5-17(14,15)6-4-8/h7-8H,3-6H2,1-2H3,(H,11,12,13) |
| InChIKey | ZLMMSVFPJXKAIS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |