About N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine
N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65271648) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 65271648 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)CCCNc1ncns1 |
| InChI | InChI=1S/C8H15N3S/c1-7(2)4-3-5-9-8-10-6-11-12-8/h6-7H,3-5H2,1-2H3,(H,9,10,11) |
| InChIKey | NKHTYZCCXHOTON-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine (CID 65271648) is N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine is CC(C)CCCNc1ncns1.
What is the InChIKey of N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine?
The InChIKey is NKHTYZCCXHOTON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3S/c1-7(2)4-3-5-9-8-10-6-11-12-8/h6-7H,3-5H2,1-2H3,(H,9,10,11).
What are the key properties of N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine?
N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine has a molecular weight of 185.30 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 65271648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).