C7H14N4S — CID 65272512
N'-(3-ethyl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine (PubChem CID 65272512) has the molecular formula C7H14N4S and a molecular weight of 186.28 g/mol. Its IUPAC name is N'-(3-ethyl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine.
| Compound Name | N'-(3-ethyl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 65272512 |
| Molecular Formula | C7H14N4S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | N'-(3-ethyl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine |
| SMILES | CCc1nsc(NCCCN)n1 |
| InChI | InChI=1S/C7H14N4S/c1-2-6-10-7(12-11-6)9-5-3-4-8/h2-5,8H2,1H3,(H,9,10,11) |
| InChIKey | IMMCBXBSQYEZAE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|