4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid

C9H6N2O2S2 — CID 65272560

IUPAC4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid
SMILESO=C(O)c1ccc(Sc2ncns2)cc1
InChIInChI=1S/C9H6N2O2S2/c12-8(13)6-1-3-7(4-2-6)14-9-10-5-11-15-9/h1-5H,(H,12,13)
InChIKeyVCBBHMVNXXZQFL-UHFFFAOYSA-N
MW238.29 g/mol
LogP2.39
Rot. Bonds3

About 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid

4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid (PubChem CID 65272560) has the molecular formula C9H6N2O2S2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid.

Molecular Properties

Compound Name4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid
PubChem CID65272560
Molecular FormulaC9H6N2O2S2
Molecular Weight238.29 g/mol
Exact Mass237.99
IUPAC Name4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid
SMILESO=C(O)c1ccc(Sc2ncns2)cc1
InChIInChI=1S/C9H6N2O2S2/c12-8(13)6-1-3-7(4-2-6)14-9-10-5-11-15-9/h1-5H,(H,12,13)
InChIKeyVCBBHMVNXXZQFL-UHFFFAOYSA-N
XLogP2.39
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.29
LogP ≤ 52.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid?
The IUPAC name of 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid (CID 65272560) is 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid.
What is the SMILES notation for 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid?
The canonical SMILES for 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid is O=C(O)c1ccc(Sc2ncns2)cc1.
What is the InChIKey of 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid?
The InChIKey is VCBBHMVNXXZQFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2S2/c12-8(13)6-1-3-7(4-2-6)14-9-10-5-11-15-9/h1-5H,(H,12,13).
What are the key properties of 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid?
4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid has a molecular weight of 238.29 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid is sourced from PubChem (CID 65272560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).