About 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine
1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine (PubChem CID 65272741) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine.
Molecular Properties
| Compound Name | 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine |
| PubChem CID | 65272741 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine |
| SMILES | CCCC(N)Cc1nc(C)ns1 |
| InChI | InChI=1S/C8H15N3S/c1-3-4-7(9)5-8-10-6(2)11-12-8/h7H,3-5,9H2,1-2H3 |
| InChIKey | XNBRHWOCBXTJDF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine?
The IUPAC name of 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine (CID 65272741) is 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine.
What is the SMILES notation for 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine?
The canonical SMILES for 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine is CCCC(N)Cc1nc(C)ns1.
What is the InChIKey of 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine?
The InChIKey is XNBRHWOCBXTJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3S/c1-3-4-7(9)5-8-10-6(2)11-12-8/h7H,3-5,9H2,1-2H3.
What are the key properties of 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine?
1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine has a molecular weight of 185.30 g/mol, XLogP of 1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-amine is sourced from PubChem (CID 65272741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).