About 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile
3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile (PubChem CID 65272929) has the molecular formula C6H6BrN3S
and a molecular weight of 232.11 g/mol. Its IUPAC name is 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile |
| PubChem CID | 65272929 |
| Molecular Formula | C6H6BrN3S |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile |
| SMILES | Cc1nsc(C(C#N)CBr)n1 |
| InChI | InChI=1S/C6H6BrN3S/c1-4-9-6(11-10-4)5(2-7)3-8/h5H,2H2,1H3 |
| InChIKey | KEHWJVAGFAHQBY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile?
The IUPAC name of 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile (CID 65272929) is 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile.
What is the SMILES notation for 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile?
The canonical SMILES for 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile is Cc1nsc(C(C#N)CBr)n1.
What is the InChIKey of 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile?
The InChIKey is KEHWJVAGFAHQBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN3S/c1-4-9-6(11-10-4)5(2-7)3-8/h5H,2H2,1H3.
What are the key properties of 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile?
3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile has a molecular weight of 232.11 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(3-methyl-1,2,4-thiadiazol-5-yl)propanenitrile is sourced from PubChem (CID 65272929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).