About 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline
4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline (PubChem CID 65272957) has the molecular formula C9H8FN3OS
and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline.
Molecular Properties
| Compound Name | 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline |
| PubChem CID | 65272957 |
| Molecular Formula | C9H8FN3OS |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline |
| SMILES | Cc1nsc(Oc2cc(F)ccc2N)n1 |
| InChI | InChI=1S/C9H8FN3OS/c1-5-12-9(15-13-5)14-8-4-6(10)2-3-7(8)11/h2-4H,11H2,1H3 |
| InChIKey | UYYXIFFYVPYPSG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline?
The IUPAC name of 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline (CID 65272957) is 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline.
What is the SMILES notation for 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline?
The canonical SMILES for 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline is Cc1nsc(Oc2cc(F)ccc2N)n1.
What is the InChIKey of 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline?
The InChIKey is UYYXIFFYVPYPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3OS/c1-5-12-9(15-13-5)14-8-4-6(10)2-3-7(8)11/h2-4H,11H2,1H3.
What are the key properties of 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline?
4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline has a molecular weight of 225.25 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline is sourced from PubChem (CID 65272957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).