About 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol
4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol (PubChem CID 65273411) has the molecular formula C9H16N2OS
and a molecular weight of 200.31 g/mol. Its IUPAC name is 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol.
Molecular Properties
| Compound Name | 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol |
| PubChem CID | 65273411 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol |
| SMILES | Cc1nsc(C(C(C)C)C(C)O)n1 |
| InChI | InChI=1S/C9H16N2OS/c1-5(2)8(6(3)12)9-10-7(4)11-13-9/h5-6,8,12H,1-4H3 |
| InChIKey | GSKPJWBTWMYMTE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol?
The IUPAC name of 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol (CID 65273411) is 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol.
What is the SMILES notation for 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol?
The canonical SMILES for 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol is Cc1nsc(C(C(C)C)C(C)O)n1.
What is the InChIKey of 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol?
The InChIKey is GSKPJWBTWMYMTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2OS/c1-5(2)8(6(3)12)9-10-7(4)11-13-9/h5-6,8,12H,1-4H3.
What are the key properties of 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol?
4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol has a molecular weight of 200.31 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)pentan-2-ol is sourced from PubChem (CID 65273411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).