About 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol
3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol (PubChem CID 65273533) has the molecular formula C7H12N2OS
and a molecular weight of 172.25 g/mol. Its IUPAC name is 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol.
Molecular Properties
| Compound Name | 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol |
| PubChem CID | 65273533 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol |
| SMILES | Cc1nsc(C(C)C(C)O)n1 |
| InChI | InChI=1S/C7H12N2OS/c1-4(5(2)10)7-8-6(3)9-11-7/h4-5,10H,1-3H3 |
| InChIKey | IKOKWSNVUSEZRB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol?
The IUPAC name of 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol (CID 65273533) is 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol.
What is the SMILES notation for 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol?
The canonical SMILES for 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol is Cc1nsc(C(C)C(C)O)n1.
What is the InChIKey of 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol?
The InChIKey is IKOKWSNVUSEZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2OS/c1-4(5(2)10)7-8-6(3)9-11-7/h4-5,10H,1-3H3.
What are the key properties of 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol?
3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol has a molecular weight of 172.25 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-1,2,4-thiadiazol-5-yl)butan-2-ol is sourced from PubChem (CID 65273533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).