C12H22N4S — CID 65273588
N-[[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]methyl]propan-1-amine (PubChem CID 65273588) has the molecular formula C12H22N4S and a molecular weight of 254.40 g/mol. Its IUPAC name is N-[[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65273588 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-[[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCN(c2nc(C)ns2)CC1 |
| InChI | InChI=1S/C12H22N4S/c1-3-6-13-9-11-4-7-16(8-5-11)12-14-10(2)15-17-12/h11,13H,3-9H2,1-2H3 |
| InChIKey | ZCLJNGDJWFQVQH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|