C10H9F2N3S — CID 65273852
N-[2-(3,5-difluorophenyl)ethyl]-1,2,4-thiadiazol-5-amine (PubChem CID 65273852) has the molecular formula C10H9F2N3S and a molecular weight of 241.27 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65273852 |
| Molecular Formula | C10H9F2N3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-1,2,4-thiadiazol-5-amine |
| SMILES | Fc1cc(F)cc(CCNc2ncns2)c1 |
| InChI | InChI=1S/C10H9F2N3S/c11-8-3-7(4-9(12)5-8)1-2-13-10-14-6-15-16-10/h3-6H,1-2H2,(H,13,14,15) |
| InChIKey | IOEAMJPRYAXSHT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |