About 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol
1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol (PubChem CID 65273878) has the molecular formula C6H11N3O2S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol |
| PubChem CID | 65273878 |
| Molecular Formula | C6H11N3O2S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol |
| SMILES | COCC(O)CNc1ncns1 |
| InChI | InChI=1S/C6H11N3O2S/c1-11-3-5(10)2-7-6-8-4-9-12-6/h4-5,10H,2-3H2,1H3,(H,7,8,9) |
| InChIKey | HEAQSRYUDDPRRS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol?
The IUPAC name of 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol (CID 65273878) is 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol.
What is the SMILES notation for 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol?
The canonical SMILES for 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol is COCC(O)CNc1ncns1.
What is the InChIKey of 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol?
The InChIKey is HEAQSRYUDDPRRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2S/c1-11-3-5(10)2-7-6-8-4-9-12-6/h4-5,10H,2-3H2,1H3,(H,7,8,9).
What are the key properties of 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol?
1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol has a molecular weight of 189.24 g/mol, XLogP of -0.04, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-(1,2,4-thiadiazol-5-ylamino)propan-2-ol is sourced from PubChem (CID 65273878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).