About 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol
1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol (PubChem CID 65273931) has the molecular formula C9H17N3O2S
and a molecular weight of 231.32 g/mol. Its IUPAC name is 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol.
Molecular Properties
| Compound Name | 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol |
| PubChem CID | 65273931 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol |
| SMILES | CCCc1nsc(NCC(O)COC)n1 |
| InChI | InChI=1S/C9H17N3O2S/c1-3-4-8-11-9(15-12-8)10-5-7(13)6-14-2/h7,13H,3-6H2,1-2H3,(H,10,11,12) |
| InChIKey | ZMWCBAMFMQVTIK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol?
The IUPAC name of 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol (CID 65273931) is 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol.
What is the SMILES notation for 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol?
The canonical SMILES for 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol is CCCc1nsc(NCC(O)COC)n1.
What is the InChIKey of 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol?
The InChIKey is ZMWCBAMFMQVTIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2S/c1-3-4-8-11-9(15-12-8)10-5-7(13)6-14-2/h7,13H,3-6H2,1-2H3,(H,10,11,12).
What are the key properties of 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol?
1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol has a molecular weight of 231.32 g/mol, XLogP of 0.91, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-[(3-propyl-1,2,4-thiadiazol-5-yl)amino]propan-2-ol is sourced from PubChem (CID 65273931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).