C9H14F3N3OS — CID 65274037
3-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine (PubChem CID 65274037) has the molecular formula C9H14F3N3OS and a molecular weight of 269.29 g/mol. Its IUPAC name is 3-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65274037 |
| Molecular Formula | C9H14F3N3OS |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 3-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CCCc1nsc(NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H14F3N3OS/c1-2-3-7-14-8(17-15-7)13-4-5-16-6-9(10,11)12/h2-6H2,1H3,(H,13,14,15) |
| InChIKey | JIUNVAGHEIJCKI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|