About spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one
spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one (PubChem CID 652743) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one.
Molecular Properties
| Compound Name | spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one |
| PubChem CID | 652743 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one |
| SMILES | O=C1NC2(CCCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C13H15NO2/c15-12-10-6-2-3-7-11(10)16-13(14-12)8-4-1-5-9-13/h2-3,6-7H,1,4-5,8-9H2,(H,14,15) |
| InChIKey | GMKQOWMDPZAYKG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one?
The IUPAC name of spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one (CID 652743) is spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one.
What is the SMILES notation for spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one?
The canonical SMILES for spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one is O=C1NC2(CCCCC2)Oc2ccccc21.
What is the InChIKey of spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one?
The InChIKey is GMKQOWMDPZAYKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c15-12-10-6-2-3-7-11(10)16-13(14-12)8-4-1-5-9-13/h2-3,6-7H,1,4-5,8-9H2,(H,14,15).
What are the key properties of spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one?
spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one has a molecular weight of 217.27 g/mol, XLogP of 2.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3H-1,3-benzoxazine-2,1'-cyclohexane]-4-one is sourced from PubChem (CID 652743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).