C12H13F2N3OS — CID 65274424
4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-2,5-difluoroaniline (PubChem CID 65274424) has the molecular formula C12H13F2N3OS and a molecular weight of 285.32 g/mol. Its IUPAC name is 4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-2,5-difluoroaniline.
| Compound Name | 4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 65274424 |
| Molecular Formula | C12H13F2N3OS |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-2,5-difluoroaniline |
| SMILES | CC(C)(C)c1nsc(Oc2cc(F)c(N)cc2F)n1 |
| InChI | InChI=1S/C12H13F2N3OS/c1-12(2,3)10-16-11(19-17-10)18-9-5-6(13)8(15)4-7(9)14/h4-5H,15H2,1-3H3 |
| InChIKey | QZGCGWHKQKSJGG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|