About 2-(1,2,4-thiadiazol-5-yloxy)aniline
2-(1,2,4-thiadiazol-5-yloxy)aniline (PubChem CID 65274530) has the molecular formula C8H7N3OS
and a molecular weight of 193.23 g/mol. Its IUPAC name is 2-(1,2,4-thiadiazol-5-yloxy)aniline.
Molecular Properties
| Compound Name | 2-(1,2,4-thiadiazol-5-yloxy)aniline |
| PubChem CID | 65274530 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 2-(1,2,4-thiadiazol-5-yloxy)aniline |
| SMILES | Nc1ccccc1Oc1ncns1 |
| InChI | InChI=1S/C8H7N3OS/c9-6-3-1-2-4-7(6)12-8-10-5-11-13-8/h1-5H,9H2 |
| InChIKey | BGHKOHJMYMTVGD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2,4-thiadiazol-5-yloxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-thiadiazol-5-yloxy)aniline?
The IUPAC name of 2-(1,2,4-thiadiazol-5-yloxy)aniline (CID 65274530) is 2-(1,2,4-thiadiazol-5-yloxy)aniline.
What is the SMILES notation for 2-(1,2,4-thiadiazol-5-yloxy)aniline?
The canonical SMILES for 2-(1,2,4-thiadiazol-5-yloxy)aniline is Nc1ccccc1Oc1ncns1.
What is the InChIKey of 2-(1,2,4-thiadiazol-5-yloxy)aniline?
The InChIKey is BGHKOHJMYMTVGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3OS/c9-6-3-1-2-4-7(6)12-8-10-5-11-13-8/h1-5H,9H2.
What are the key properties of 2-(1,2,4-thiadiazol-5-yloxy)aniline?
2-(1,2,4-thiadiazol-5-yloxy)aniline has a molecular weight of 193.23 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-thiadiazol-5-yloxy)aniline is sourced from PubChem (CID 65274530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).