About 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol
2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol (PubChem CID 65274600) has the molecular formula C12H21N3OS
and a molecular weight of 255.39 g/mol. Its IUPAC name is 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol |
| PubChem CID | 65274600 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol |
| SMILES | CCCc1nsc(N2CCCCC2CCO)n1 |
| InChI | InChI=1S/C12H21N3OS/c1-2-5-11-13-12(17-14-11)15-8-4-3-6-10(15)7-9-16/h10,16H,2-9H2,1H3 |
| InChIKey | JXVVTUMPNSZTAT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol?
The IUPAC name of 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol (CID 65274600) is 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol.
What is the SMILES notation for 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol?
The canonical SMILES for 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol is CCCc1nsc(N2CCCCC2CCO)n1.
What is the InChIKey of 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol?
The InChIKey is JXVVTUMPNSZTAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3OS/c1-2-5-11-13-12(17-14-11)15-8-4-3-6-10(15)7-9-16/h10,16H,2-9H2,1H3.
What are the key properties of 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol?
2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol has a molecular weight of 255.39 g/mol, XLogP of 2.23, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol is sourced from PubChem (CID 65274600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).