About 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid
1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid (PubChem CID 65274629) has the molecular formula C9H8N4O2S
and a molecular weight of 236.26 g/mol. Its IUPAC name is 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid |
| PubChem CID | 65274629 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(-c2nc(C3CC3)ns2)n1 |
| InChI | InChI=1S/C9H8N4O2S/c14-8(15)6-3-4-13(11-6)9-10-7(12-16-9)5-1-2-5/h3-5H,1-2H2,(H,14,15) |
| InChIKey | RMMNNRXEDFMHEB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid?
The IUPAC name of 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid (CID 65274629) is 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid.
What is the SMILES notation for 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid?
The canonical SMILES for 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid is O=C(O)c1ccn(-c2nc(C3CC3)ns2)n1.
What is the InChIKey of 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid?
The InChIKey is RMMNNRXEDFMHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O2S/c14-8(15)6-3-4-13(11-6)9-10-7(12-16-9)5-1-2-5/h3-5H,1-2H2,(H,14,15).
What are the key properties of 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid?
1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid has a molecular weight of 236.26 g/mol, XLogP of 1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazole-3-carboxylic acid is sourced from PubChem (CID 65274629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).