About methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate
methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 65274645) has the molecular formula C12H19N3O4S
and a molecular weight of 301.37 g/mol. Its IUPAC name is methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate |
| PubChem CID | 65274645 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)c1nc(C(C)(C)C)ns1 |
| InChI | InChI=1S/C12H19N3O4S/c1-12(2,3)10-13-11(20-14-10)15(6-8(16)18-4)7-9(17)19-5/h6-7H2,1-5H3 |
| InChIKey | LIKAJHDYUPEEAX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate?
The IUPAC name of methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate (CID 65274645) is methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate.
What is the SMILES notation for methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate?
The canonical SMILES for methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate is COC(=O)CN(CC(=O)OC)c1nc(C(C)(C)C)ns1.
What is the InChIKey of methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate?
The InChIKey is LIKAJHDYUPEEAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O4S/c1-12(2,3)10-13-11(20-14-10)15(6-8(16)18-4)7-9(17)19-5/h6-7H2,1-5H3.
What are the key properties of methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate?
methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate has a molecular weight of 301.37 g/mol, XLogP of 0.99, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)-(2-methoxy-2-oxoethyl)amino]acetate is sourced from PubChem (CID 65274645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).