About 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine
4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine (PubChem CID 65275012) has the molecular formula C7H6N4S2
and a molecular weight of 210.29 g/mol. Its IUPAC name is 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine |
| PubChem CID | 65275012 |
| Molecular Formula | C7H6N4S2 |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine |
| SMILES | Nc1cnccc1Sc1ncns1 |
| InChI | InChI=1S/C7H6N4S2/c8-5-3-9-2-1-6(5)12-7-10-4-11-13-7/h1-4H,8H2 |
| InChIKey | KRDDRFRHLFHXDE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine?
The IUPAC name of 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine (CID 65275012) is 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine.
What is the SMILES notation for 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine?
The canonical SMILES for 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine is Nc1cnccc1Sc1ncns1.
What is the InChIKey of 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine?
The InChIKey is KRDDRFRHLFHXDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4S2/c8-5-3-9-2-1-6(5)12-7-10-4-11-13-7/h1-4H,8H2.
What are the key properties of 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine?
4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine has a molecular weight of 210.29 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,4-thiadiazol-5-ylsulfanyl)pyridin-3-amine is sourced from PubChem (CID 65275012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).